Methyl 5-Hydroxy-6-methoxynicotinate - CAS 166742-16-1
Catalog: |
BB012309 |
Product Name: |
Methyl 5-Hydroxy-6-methoxynicotinate |
CAS: |
166742-16-1 |
Synonyms: |
5-hydroxy-6-methoxy-3-pyridinecarboxylic acid methyl ester; methyl 5-hydroxy-6-methoxypyridine-3-carboxylate |
IUPAC Name: | methyl 5-hydroxy-6-methoxypyridine-3-carboxylate |
Description: | Methyl 5-Hydroxy-6-methoxynicotinate (CAS# 166742-16-1 ) is a useful research chemical. |
Molecular Weight: | 183.16 |
Molecular Formula: | C8H9NO4 |
Canonical SMILES: | COC1=C(C=C(C=N1)C(=O)OC)O |
InChI: | InChI=1S/C8H9NO4/c1-12-7-6(10)3-5(4-9-7)8(11)13-2/h3-4,10H,1-2H3 |
InChI Key: | RLHNCRFEGUYTPO-UHFFFAOYSA-N |
LogP: | 0.58240 |
Publication Number | Title | Priority Date |
WO-2020205501-A1 | Complement modulators and related methods | 20190329 |
WO-2013091285-A1 | Urea compound, preparation method and use thereof | 20111221 |
AU-2010313162-A1 | Acylamino-substituted cyclic carboxylic acid derivatives and their use as pharmaceuticals | 20091102 |
CA-2779268-A1 | Acylamino-substituted cyclic carboxylic acid derivatives and their use as pharmaceuticals | 20091102 |
EP-2496556-A1 | Acylamino-substituted cyclic carboxylic acid derivatives and their use as pharmaceuticals | 20091102 |
Complexity: | 185 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 183.05315777 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 183.05315777 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 68.6 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS