methyl 5-bromo-1H-imidazole-4-carboxylate - CAS 1093261-46-1
Catalog: |
BB002438 |
Product Name: |
methyl 5-bromo-1H-imidazole-4-carboxylate |
CAS: |
1093261-46-1 |
Synonyms: |
5-bromo-1H-imidazole-4-carboxylic acid methyl ester; methyl 5-bromo-1H-imidazole-4-carboxylate |
IUPAC Name: | methyl 5-bromo-1H-imidazole-4-carboxylate |
Description: | methyl 5-bromo-1H-imidazole-4-carboxylate (CAS# 1093261-46-1 ) is a useful research chemical. |
Molecular Weight: | 205.011 |
Molecular Formula: | C5H5BrN2O2 |
Canonical SMILES: | COC(=O)C1=C(NC=N1)Br |
InChI: | InChI=1S/C5H5BrN2O2/c1-10-5(9)3-4(6)8-2-7-3/h2H,1H3,(H,7,8) |
InChI Key: | GRIZGYQGAGYKNL-UHFFFAOYSA-N |
Storage: | Inert atmosphere, 2-8 °C |
LogP: | 0.95880 |
Publication Number | Title | Priority Date |
CN-111393459-A | SHP2 inhibitor and application thereof | 20200416 |
JP-2021119130-A | A drug consisting of a fused lactam derivative | 20200129 |
US-2021128532-A1 | Heterocyclic carboxylate compounds as glycolate oxidase inhibitors | 20191101 |
WO-2021086874-A1 | Heterocyclic carboxylate compounds as glycolate oxidase inhibitors | 20191101 |
US-2020172543-A1 | Condensed lactam derivative | 20180723 |
Complexity: | 142 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 203.95344 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 203.95344 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 55 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Imidazoles
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS