Methyl 5-Amino-2-fluorobenzoate - CAS 56741-34-5
Catalog: |
BB029478 |
Product Name: |
Methyl 5-Amino-2-fluorobenzoate |
CAS: |
56741-34-5 |
Synonyms: |
5-amino-2-fluorobenzoic acid methyl ester; methyl 5-amino-2-fluorobenzoate |
IUPAC Name: | methyl 5-amino-2-fluorobenzoate |
Description: | Methyl 5-Amino-2-fluorobenzoate (CAS# 56741-34-5) is a useful research chemical. |
Molecular Weight: | 169.15 |
Molecular Formula: | C8H8FNO2 |
Canonical SMILES: | COC(=O)C1=C(C=CC(=C1)N)F |
InChI: | InChI=1S/C8H8FNO2/c1-12-8(11)6-4-5(10)2-3-7(6)9/h2-4H,10H2,1H3 |
InChI Key: | ILVPFTMKCHREDJ-UHFFFAOYSA-N |
Boiling Point: | 302.319 ℃ at 760 mmHg |
Density: | 1.264 g/cm3 |
LogP: | 1.77570 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
KR-20210024983-A | Indole Carboxamide Derivative and Pharmaceutical Composition Comprising the Same | 20190826 |
WO-2021040393-A1 | Indole carboxamide derivative and pharmaceutical composition containing same | 20190826 |
WO-2021018173-A1 | Adenosine receptor antagonist | 20190730 |
TW-201940462-A | Compound | 20180126 |
WO-2019145726-A1 | Compounds | 20180126 |
Complexity: | 174 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 169.05390666 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 169.05390666 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 52.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS