Methyl 5,6-dimethoxypicolinate - CAS 324028-87-7
Catalog: |
BB021279 |
Product Name: |
Methyl 5,6-dimethoxypicolinate |
CAS: |
324028-87-7 |
Synonyms: |
methyl 5,6-dimethoxypyridine-2-carboxylate |
IUPAC Name: | methyl 5,6-dimethoxypyridine-2-carboxylate |
Description: | Methyl 5,6-dimethoxypicolinate (CAS# 324028-87-7) is a useful research chemical. |
Molecular Weight: | 197.19 |
Molecular Formula: | C9H11NO4 |
Canonical SMILES: | COC1=C(N=C(C=C1)C(=O)OC)OC |
InChI: | InChI=1S/C9H11NO4/c1-12-7-5-4-6(9(11)14-3)10-8(7)13-2/h4-5H,1-3H3 |
InChI Key: | PVGFGXWPUXNVFR-UHFFFAOYSA-N |
MDL: | MFCD11857720 |
LogP: | 0.88540 |
Publication Number | Title | Priority Date |
JP-4594574-B2 | N- (benzylsulfonyl) picolinic acid amide derivative, process for producing the same and herbicide | 19990803 |
WO-0109098-A1 | N-(benzylsulfonyl)picolinamide derivatives, process for the preparation thereof and herbicides | 19990803 |
AU-5879898-A | N-(phenylsulfonyl) picolinamide derivatives, process for producing the same, and herbicide | 19980213 |
AU-754616-B2 | N-(phenylsulfonyl) picolinamide derivatives, process for producing the same, and herbicide | 19980213 |
CA-2320217-C | N-(phenylsulfonyl) picolinamide derivatives, process for producing the same, and herbicide | 19980213 |
Complexity: | 197 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 197.06880783 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 197.06880783 |
Rotatable Bond Count: | 4 |
Topological Polar Surface Area: | 57.6 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS