Methyl 4-Oxo-1-(4-(trifluoromethyl)phenyl)cyclohexanecarboxylate - CAS 1242314-02-8
Catalog: |
BB005838 |
Product Name: |
Methyl 4-Oxo-1-(4-(trifluoromethyl)phenyl)cyclohexanecarboxylate |
CAS: |
1242314-02-8 |
Synonyms: |
4-oxo-1-[4-(trifluoromethyl)phenyl]-1-cyclohexanecarboxylic acid methyl ester; methyl 4-oxo-1-[4-(trifluoromethyl)phenyl]cyclohexane-1-carboxylate |
IUPAC Name: | methyl 4-oxo-1-[4-(trifluoromethyl)phenyl]cyclohexane-1-carboxylate |
Description: | Methyl 4-Oxo-1-(4-(trifluoromethyl)phenyl)cyclohexanecarboxylate (CAS# 1242314-02-8 ) is a useful research chemical. |
Molecular Weight: | 300.27 |
Molecular Formula: | C15H15F3O3 |
Canonical SMILES: | COC(=O)C1(CCC(=O)CC1)C2=CC=C(C=C2)C(F)(F)F |
InChI: | InChI=1S/C15H15F3O3/c1-21-13(20)14(8-6-12(19)7-9-14)10-2-4-11(5-3-10)15(16,17)18/h2-5H,6-9H2,1H3 |
InChI Key: | HBWPXROJSKQDGI-UHFFFAOYSA-N |
LogP: | 0.17660 |
Publication Number | Title | Priority Date |
AU-2010218714-A1 | Nitrogen-containing fused heterocyclic compounds and their use as beta amyloid production inhibitors | 20090226 |
CA-2753696-A1 | Nitrogen-containing fused heterocyclic compounds and their use as beta amyloid production inhibitors | 20090226 |
EP-2401276-A1 | Nitrogen-containing fused heterocyclic compounds and their use as beta amyloid production inhibitors | 20090226 |
EP-2401276-B1 | Nitrogen-containing fused heterocyclic compounds and their use as beta amyloid production inhibitors | 20090226 |
EP-2615090-A1 | Nitrogen-containing fused heterocyclic compounds and their use as beta amyloid production inhibitors | 20090226 |
Complexity: | 399 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 300.09732882 |
Formal Charge: | 0 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 300.09732882 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 43.4 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS