Methyl 4-Methoxy-1H-indazole-6-carboxylate - CAS 885521-13-1
Catalog: |
BB038991 |
Product Name: |
Methyl 4-Methoxy-1H-indazole-6-carboxylate |
CAS: |
885521-13-1 |
Synonyms: |
4-methoxy-1H-indazole-6-carboxylic acid methyl ester; methyl 4-methoxy-1H-indazole-6-carboxylate |
IUPAC Name: | methyl 4-methoxy-1H-indazole-6-carboxylate |
Description: | Methyl 4-Methoxy-1H-indazole-6-carboxylate (CAS# 885521-13-1) is a useful research chemical. |
Molecular Weight: | 206.20 |
Molecular Formula: | C10H10N2O3 |
Canonical SMILES: | COC1=CC(=CC2=C1C=NN2)C(=O)OC |
InChI: | InChI=1S/C10H10N2O3/c1-14-9-4-6(10(13)15-2)3-8-7(9)5-11-12-8/h3-5H,1-2H3,(H,11,12) |
InChI Key: | WWTOCSIETVUARU-UHFFFAOYSA-N |
LogP: | 1.35810 |
Publication Number | Title | Priority Date |
JP-2013518031-A | Substituted indazole amides and their use as glucokinase activators | 20100129 |
CA-2754685-A1 | Substituted indazole amides | 20090311 |
EP-2406230-A1 | Substituted indazole amides and their use as glucokinase activators | 20090311 |
US-2011319379-A1 | Substituted Indazole Amides And Their Use As Glucokinase Activators | 20090311 |
WO-2010103438-A1 | Substituted indazole amides and their use as glucokinase activators | 20090311 |
Complexity: | 247 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 206.06914219 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 206.06914219 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 64.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS