Methyl 4-Bromo-3-oxopentanoate - CAS 105983-77-5
Catalog: |
BB001748 |
Product Name: |
Methyl 4-Bromo-3-oxopentanoate |
CAS: |
105983-77-5 |
Synonyms: |
4-bromo-3-oxopentanoic acid methyl ester; methyl 4-bromo-3-oxopentanoate |
IUPAC Name: | methyl 4-bromo-3-oxopentanoate |
Description: | Methyl 4-Bromo-3-oxopentanoate (CAS# 105983-77-5) is a useful research chemical compound. |
Molecular Weight: | 209.04 |
Molecular Formula: | C6H9BrO3 |
Canonical SMILES: | CC(C(=O)CC(=O)OC)Br |
InChI: | InChI=1S/C6H9BrO3/c1-4(7)5(8)3-6(9)10-2/h4H,3H2,1-2H3 |
InChI Key: | HCBQTGAZENNMLM-UHFFFAOYSA-N |
Boiling Point: | 224.12 ℃ at 760 mmHg |
Density: | 1.475 g/cm3 |
Storage: | Inert atmosphere, 2-8 ℃ |
LogP: | 0.90200 |
Publication Number | Title | Priority Date |
EP-3548023-A1 | Methods of dose administration for treating or preventing cognitive impairment using indane acetic acid derivatives | 20161202 |
US-2018153859-A1 | Methods of treating or preventing cognitive impairment using indane acetic acid derivatives based on apoe4 genotype | 20161202 |
US-2018153860-A1 | Methods of dose administration for treating or preventing cognitive impairment using indane acetic acid derivatives | 20161202 |
WO-2018102358-A1 | Methods of treating or preventing cognitive impairment using indane acetic acid derivatives based on apoe4 genotype | 20161202 |
WO-2018102399-A1 | Methods of dose administration for treating or preventing cognitive impairment using indane acetic acid derivatives | 20161202 |
Complexity: | 144 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 207.97351 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 207.97351 |
Rotatable Bond Count: | 4 |
Topological Polar Surface Area: | 43.4 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS