Methyl 3-Oxo-3-(2-pyridyl)propionate - CAS 75418-74-5
Catalog: |
BB035323 |
Product Name: |
Methyl 3-Oxo-3-(2-pyridyl)propionate |
CAS: |
75418-74-5 |
Synonyms: |
3-oxo-3-(2-pyridinyl)propanoic acid methyl ester; methyl 3-oxo-3-pyridin-2-ylpropanoate |
IUPAC Name: | methyl 3-oxo-3-pyridin-2-ylpropanoate |
Description: | Methyl 3-Oxo-3-(2-pyridyl)propionate (CAS# 75418-74-5) is a useful research chemical. |
Molecular Weight: | 179.17 |
Molecular Formula: | C9H9NO3 |
Canonical SMILES: | COC(=O)CC(=O)C1=CC=CC=N1 |
InChI: | InChI=1S/C9H9NO3/c1-13-9(12)6-8(11)7-4-2-3-5-10-7/h2-5H,6H2,1H3 |
InChI Key: | INPIXQVBVNGVBU-UHFFFAOYSA-N |
LogP: | 0.82740 |
Publication Number | Title | Priority Date |
TW-201829363-A | Method for producing tri-side oxypropane compound | 20161205 |
AU-2016232330-A1 | KV1.3 inhibitors and their medical application | 20150313 |
AU-2016232330-B2 | KV1.3 inhibitors and their medical application | 20150313 |
AU-2016232338-A1 | Kv1.3 inhibitors and their medical application | 20150313 |
CA-2979501-A1 | Kv1.3 inhibitors and their medical application | 20150313 |
Complexity: | 203 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 179.058243149 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 179.058243149 |
Rotatable Bond Count: | 4 |
Topological Polar Surface Area: | 56.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS