Methyl 3-Oxo-1-pyrrolidinecarboxylate - CAS 69079-09-0
Catalog: |
BB033692 |
Product Name: |
Methyl 3-Oxo-1-pyrrolidinecarboxylate |
CAS: |
69079-09-0 |
Synonyms: |
3-oxo-1-pyrrolidinecarboxylic acid methyl ester; methyl 3-oxopyrrolidine-1-carboxylate |
IUPAC Name: | methyl 3-oxopyrrolidine-1-carboxylate |
Description: | Methyl 3-Oxo-1-pyrrolidinecarboxylate (CAS# 69079-09-0) is a useful research chemical compound. |
Molecular Weight: | 143.14 |
Molecular Formula: | C6H9NO3 |
Canonical SMILES: | COC(=O)N1CCC(=O)C1 |
InChI: | InChI=1S/C6H9NO3/c1-10-6(9)7-3-2-5(8)4-7/h2-4H2,1H3 |
InChI Key: | UOTZNSARDKOPCP-UHFFFAOYSA-N |
LogP: | -0.03450 |
Publication Number | Title | Priority Date |
CN-109096416-B | Olefin polymerization catalyst component, process for producing the same, olefin polymerization catalyst, and process for producing olefin polymer | 20170621 |
CN-109096415-B | Olefin polymerization catalyst component, process for producing the same, olefin polymerization catalyst, and process for producing olefin polymer | 20170621 |
JP-2014133739-A | A pharmaceutical comprising an indazole derivative or a pyrrolopyridine derivative | 20121212 |
AU-2012267797-A1 | Indazole- and pyrrolopyridine-derivative and pharmaceutical use thereof | 20110607 |
AU-2012267797-A2 | Indazole- and pyrrolopyridine-derivative and pharmaceutical use thereof | 20110607 |
Complexity: | 166 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 143.058243149 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 143.058243149 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 46.6 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS