Methyl 3-Iodopyrazine-2-carboxylate - CAS 173290-17-0
Catalog: |
BB012908 |
Product Name: |
Methyl 3-Iodopyrazine-2-carboxylate |
CAS: |
173290-17-0 |
Synonyms: |
3-iodo-2-pyrazinecarboxylic acid methyl ester; methyl 3-iodopyrazine-2-carboxylate |
IUPAC Name: | methyl 3-iodopyrazine-2-carboxylate |
Description: | Methyl 3-Iodopyrazine-2-carboxylate (CAS# 173290-17-0) is a useful research chemical. |
Molecular Weight: | 264.02 |
Molecular Formula: | C6H5IN2O2 |
Canonical SMILES: | COC(=O)C1=NC=CN=C1I |
InChI: | InChI=1S/C6H5IN2O2/c1-11-6(10)4-5(7)9-3-2-8-4/h2-3H,1H3 |
InChI Key: | ZMPHVSWNACFXDA-UHFFFAOYSA-N |
Boiling Point: | 292.648 ℃ at 760 mmHg |
Density: | 1.944 g/cm3 |
LogP: | 0.86780 |
Publication Number | Title | Priority Date |
US-2021198565-A1 | Inorganic-organic hybrid core-shell nanorod and light valve having the nanorod | 20181119 |
EP-3558298-A1 | Antidiabetic spirochroman compounds | 20161220 |
US-2019337961-A1 | Antidiabetic spirochroman compounds | 20161220 |
WO-2018118670-A1 | Antidiabetic spirochroman compounds | 20161220 |
US-10968232-B2 | Antidiabetic spirochroman compounds | 20161220 |
Complexity: | 154 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 263.93957 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 263.93957 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 52.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS