Methyl 3-(Hydroxymethyl)-5-methoxybenzoate - CAS 367519-84-4
Catalog: |
BB023063 |
Product Name: |
Methyl 3-(Hydroxymethyl)-5-methoxybenzoate |
CAS: |
367519-84-4 |
Synonyms: |
3-(hydroxymethyl)-5-methoxybenzoic acid methyl ester; methyl 3-(hydroxymethyl)-5-methoxybenzoate |
IUPAC Name: | methyl 3-(hydroxymethyl)-5-methoxybenzoate |
Description: | Methyl 3-(Hydroxymethyl)-5-methoxybenzoate (CAS# 367519-84-4) is a useful research chemical. |
Molecular Weight: | 196.20 |
Molecular Formula: | C10H12O4 |
Canonical SMILES: | COC1=CC(=CC(=C1)CO)C(=O)OC |
InChI: | InChI=1S/C10H12O4/c1-13-9-4-7(6-11)3-8(5-9)10(12)14-2/h3-5,11H,6H2,1-2H3 |
InChI Key: | HZMFUMLFHICVSP-UHFFFAOYSA-N |
LogP: | 0.97410 |
Publication Number | Title | Priority Date |
EP-2900645-A1 | 3-phenylisoxazolin derivatives with herbicidal action | 20120925 |
AU-2012204508-A1 | Hedgehog antagonists having zinc binding moieties | 20110103 |
AU-2012204508-B2 | Hedgehog antagonists having zinc binding moieties | 20110103 |
AU-2015203842-A1 | Hedgehog antagonists having zinc binding moieties | 20110103 |
CA-2823385-A1 | Phenylene-containing hedgehog antagonists having zinc binding moieties | 20110103 |
Complexity: | 193 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 196.07355886 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 196.07355886 |
Rotatable Bond Count: | 4 |
Topological Polar Surface Area: | 55.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS