Methyl 3-Formyl-4-methoxybenzoate - CAS 145742-55-8
Catalog: |
BB009997 |
Product Name: |
Methyl 3-Formyl-4-methoxybenzoate |
CAS: |
145742-55-8 |
Synonyms: |
3-formyl-4-methoxybenzoic acid methyl ester; methyl 3-formyl-4-methoxybenzoate |
IUPAC Name: | methyl 3-formyl-4-methoxybenzoate |
Description: | Methyl 3-Formyl-4-methoxybenzoate (CAS# 145742-55-8 ) is a useful research chemical. |
Molecular Weight: | 194.18 |
Molecular Formula: | C10H10O4 |
Canonical SMILES: | COC1=C(C=C(C=C1)C(=O)OC)C=O |
InChI: | InChI=1S/C10H10O4/c1-13-9-4-3-7(10(12)14-2)5-8(9)6-11/h3-6H,1-2H3 |
InChI Key: | NTQXOXZCWHKHOA-UHFFFAOYSA-N |
LogP: | 1.29430 |
Publication Number | Title | Priority Date |
US-2019322658-A1 | Antiproliferation compounds and uses thereof | 20180424 |
WO-2019209759-A1 | Antiproliferation compounds and uses thereof | 20180424 |
AU-2019261308-A1 | Antiproliferation compounds and uses thereof | 20180424 |
US-10815225-B2 | Antiproliferation compounds and uses thereof | 20180424 |
BR-112020020940-A2 | antiproliferation compounds and their use | 20180424 |
Complexity: | 214 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 194.0579088 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 194.0579088 |
Rotatable Bond Count: | 4 |
Topological Polar Surface Area: | 52.6 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS