Methyl 3-(Cyclopropylamino)propanoate - CAS 77497-84-8
Catalog: |
BB035965 |
Product Name: |
Methyl 3-(Cyclopropylamino)propanoate |
CAS: |
77497-84-8 |
Synonyms: |
3-(cyclopropylamino)propanoic acid methyl ester; methyl 3-(cyclopropylamino)propanoate |
IUPAC Name: | methyl 3-(cyclopropylamino)propanoate |
Description: | Methyl 3-(Cyclopropylamino)propanoate (CAS# 77497-84-8) is a useful research chemical. |
Molecular Weight: | 143.18 |
Molecular Formula: | C7H13NO2 |
Canonical SMILES: | COC(=O)CCNC1CC1 |
InChI: | InChI=1S/C7H13NO2/c1-10-7(9)4-5-8-6-2-3-6/h6,8H,2-5H2,1H3 |
InChI Key: | IXRSFGOAMNXZBZ-UHFFFAOYSA-N |
Appearance: | Liquid |
LogP: | 0.69240 |
Publication Number | Title | Priority Date |
JP-2007314489-A | Process for producing β-alanine compound, piperidone compound and aminopiperidine compound | 20060529 |
JP-5173152-B2 | Process for producing β-alanine compound, piperidone compound and aminopiperidine compound | 20060529 |
US-5405854-A | Sulfonamidocarboxamides | 19920306 |
US-5578594-A | Sulfonamidocarboxamides | 19920306 |
US-5677448-A | Sulfonamidocarboxamides | 19920306 |
Complexity: | 121 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 143.094628657 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 143.094628657 |
Rotatable Bond Count: | 5 |
Topological Polar Surface Area: | 38.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS