Methyl 3-Chloro-4-formylbenzoate - CAS 74733-26-9
Catalog: |
BB035149 |
Product Name: |
Methyl 3-Chloro-4-formylbenzoate |
CAS: |
74733-26-9 |
Synonyms: |
3-chloro-4-formylbenzoic acid methyl ester; methyl 3-chloro-4-formylbenzoate |
IUPAC Name: | methyl 3-chloro-4-formylbenzoate |
Description: | Methyl 3-Chloro-4-formylbenzoate (CAS# 74733-26-9) is a useful research chemical. |
Molecular Weight: | 198.60 |
Molecular Formula: | C9H7ClO3 |
Canonical SMILES: | COC(=O)C1=CC(=C(C=C1)C=O)Cl |
InChI: | InChI=1S/C9H7ClO3/c1-13-9(12)6-2-3-7(5-11)8(10)4-6/h2-5H,1H3 |
InChI Key: | HTBWDEJOUJMERN-UHFFFAOYSA-N |
LogP: | 1.93910 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021161105-A1 | P2x3 modulators | 20200214 |
WO-2021032934-A1 | Enzyme inhibitors | 20190821 |
WO-2020243135-A1 | Fused heterocyclic derivatives | 20190528 |
US-2019322658-A1 | Antiproliferation compounds and uses thereof | 20180424 |
WO-2019209759-A1 | Antiproliferation compounds and uses thereof | 20180424 |
Complexity: | 205 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 198.0083718 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 198.0083718 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 43.4 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS