Methyl 3-Bromobutanoate - CAS 21249-59-2
Catalog: |
BB016728 |
Product Name: |
Methyl 3-Bromobutanoate |
CAS: |
21249-59-2 |
Synonyms: |
3-bromobutanoic acid methyl ester; methyl 3-bromobutanoate |
IUPAC Name: | methyl 3-bromobutanoate |
Description: | Methyl 3-Bromobutanoate (CAS# 21249-59-2 ) is a useful research chemical. |
Molecular Weight: | 181.03 |
Molecular Formula: | C5H9BrO2 |
Canonical SMILES: | CC(CC(=O)OC)Br |
InChI: | InChI=1S/C5H9BrO2/c1-4(6)3-5(7)8-2/h4H,3H2,1-2H3 |
InChI Key: | WJYBMWHJTZBYSO-UHFFFAOYSA-N |
Boiling Point: | 149.9 °C at 760 mmHg |
Density: | 1.413 g/cm3 |
LogP: | 1.33290 |
Publication Number | Title | Priority Date |
JP-2021001328-A | Thermoplastic resin, optical film made of it, diol compound, diester compound | 20190624 |
WO-2020262337-A1 | Thermoplastic resin, optical film made therefrom, diol compound, diester compound | 20190624 |
JP-2020176254-A | Photopolymerizable composition, coating film containing the photopolymerizable composition, and curing method thereof | 20190415 |
WO-2020213442-A1 | Photopolymerizable composition, coating film containing said photopolymerizable composition, and curing method therefor | 20190415 |
JP-2020172599-A | A photoradical polymerizable composition containing a photoradical curing oxygen inhibition reducing agent, a photoradical curing oxygen inhibition reducing agent, a coating film containing a photoradical curing oxygen inhibition reducing agent, and a curing method thereof. | 20190411 |
Complexity: | 82.5 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 179.97859 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 179.97859 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 26.3 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS