Methyl 3-Bromo-4-chlorobenzoate - CAS 107947-17-1
Catalog: |
BB002152 |
Product Name: |
Methyl 3-Bromo-4-chlorobenzoate |
CAS: |
107947-17-1 |
Synonyms: |
3-bromo-4-chlorobenzoic acid methyl ester; methyl 3-bromo-4-chlorobenzoate |
IUPAC Name: | methyl 3-bromo-4-chlorobenzoate |
Description: | Methyl 3-Bromo-4-chlorobenzoate (CAS# 107947-17-1) is a useful research chemical. |
Molecular Weight: | 249.49 |
Molecular Formula: | C8H6BrClO2 |
Canonical SMILES: | COC(=O)C1=CC(=C(C=C1)Cl)Br |
InChI: | InChI=1S/C8H6BrClO2/c1-12-8(11)5-2-3-7(10)6(9)4-5/h2-4H,1H3 |
InChI Key: | CLRJXWANIVYEHH-UHFFFAOYSA-N |
Boiling Point: | 280 ℃ |
Density: | 1.604 g/cm3 |
LogP: | 2.88910 |
Publication Number | Title | Priority Date |
TW-201938538-A | Alkynyl-substituted heterocyclic compound, preparation method therefor and medical use therefor for effectively treating and/or preventing FGFR-related diseases such as tumors | 20180316 |
WO-2018224455-A1 | Substituted cyclopropyl derivatives | 20170607 |
AU-2018252880-A1 | An isoxazole derivatives as nuclear receptor agonists and used thereof | 20170412 |
CA-3059869-A1 | Isoxazole derivatives as nuclear receptor agonists and uses thereof | 20170412 |
CN-110678450-A | Isoxazole derivatives as nuclear receptor agonists and uses thereof | 20170412 |
Complexity: | 174 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 247.92397 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 247.92397 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 26.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS