Methyl 3-Amino-5-chlorobenzoate - CAS 21961-31-9
Catalog: |
BB017225 |
Product Name: |
Methyl 3-Amino-5-chlorobenzoate |
CAS: |
21961-31-9 |
Synonyms: |
3-amino-5-chlorobenzoic acid methyl ester; methyl 3-amino-5-chlorobenzoate |
IUPAC Name: | methyl 3-amino-5-chlorobenzoate |
Description: | Methyl 3-Amino-5-chlorobenzoate (CAS# 21961-31-9) is a useful research chemical. |
Molecular Weight: | 185.61 |
Molecular Formula: | C8H8ClNO2 |
Canonical SMILES: | COC(=O)C1=CC(=CC(=C1)Cl)N |
InChI: | InChI=1S/C8H8ClNO2/c1-12-8(11)5-2-6(9)4-7(10)3-5/h2-4H,10H2,1H3 |
InChI Key: | ORKTXZHKYFWCRB-UHFFFAOYSA-N |
Boiling Point: | 329.413 ℃ at 760 mmHg |
Density: | 1.311 g/cm3 |
MDL: | MFCD11053764 |
LogP: | 2.29000 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021021951-A1 | Wdr5-myc inhibitors | 20190729 |
CN-111285806-A | Pyrazole compound and preparation method, application and pharmaceutical composition thereof | 20181206 |
WO-2020117877-A1 | Compounds, compositions and methods of use | 20181204 |
WO-2019197468-A1 | N-(cyclopropylmethyl)-5-(methylsulfonyl)-n-{1-[1-(pyrimidin-2-yl)-1h-1,2,4-triazol-5-yl]ethyl}benzamide derivatives and the corresponding pyridine-carboxamide derivatives as pesticides | 20180412 |
AU-2019250361-A1 | N-(cyclopropylmethyl)-5-(methylsulfonyl)-N-{1-[1-(pyrimidin-2-yl)-1H-1,2,4-triazol-5-yl]ethyl}benzamide derivatives and the corresponding pyridine-carboxamide derivatives as pesticides | 20180412 |
Complexity: | 174 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 185.0243562 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 185.0243562 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 52.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS