Methyl 3-Amino-4-hydroxy-5-methoxybenzoate - CAS 92643-72-6
Catalog: |
BB040593 |
Product Name: |
Methyl 3-Amino-4-hydroxy-5-methoxybenzoate |
CAS: |
92643-72-6 |
Synonyms: |
3-amino-4-hydroxy-5-methoxybenzoic acid methyl ester; methyl 3-amino-4-hydroxy-5-methoxybenzoate |
IUPAC Name: | methyl 3-amino-4-hydroxy-5-methoxybenzoate |
Description: | Methyl 3-Amino-4-hydroxy-5-methoxybenzoate (CAS# 92643-72-6) is a useful research chemical compound. |
Molecular Weight: | 197.19 |
Molecular Formula: | C9H11NO4 |
Canonical SMILES: | COC1=CC(=CC(=C1O)N)C(=O)OC |
InChI: | InChI=1S/C9H11NO4/c1-13-7-4-5(9(12)14-2)3-6(10)8(7)11/h3-4,11H,10H2,1-2H3 |
InChI Key: | VISBFCKPNAZKDH-UHFFFAOYSA-N |
MDL: | MFCD12913545 |
LogP: | 1.35080 |
Publication Number | Title | Priority Date |
WO-2020035548-A2 | Redox-active compounds and uses thereof | 20180814 |
CN-113166079-A | Redox active compounds and their use | 20180814 |
EP-3837246-A2 | Redox-active compounds and uses thereof | 20180814 |
US-2021253540-A1 | Redox-active compounds and uses thereof | 20180814 |
AU-2014277072-A1 | Substituted benzoxazoles | 20130603 |
Complexity: | 209 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 197.06880783 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 197.06880783 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 81.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS