Methyl 3-amino-2-iodobenzoate - CAS 283173-76-2
Catalog: |
BB019812 |
Product Name: |
Methyl 3-amino-2-iodobenzoate |
CAS: |
283173-76-2 |
Synonyms: |
methyl 3-amino-2-iodobenzoate |
IUPAC Name: | methyl 3-amino-2-iodobenzoate |
Description: | Methyl 3-amino-2-iodobenzoate (CAS# 283173-76-2 ) is a useful research chemical. |
Molecular Weight: | 277.06 |
Molecular Formula: | C8H8INO2 |
Canonical SMILES: | COC(=O)C1=C(C(=CC=C1)N)I |
InChI: | InChI=1S/C8H8INO2/c1-12-8(11)5-3-2-4-6(10)7(5)9/h2-4H,10H2,1H3 |
InChI Key: | NDSPWJRSUXVPSQ-UHFFFAOYSA-N |
LogP: | 2.24120 |
GHS Hazard Statement: | H301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]; H317 (100%): May cause an allergic skin reaction [Warning Sensitization, Skin] |
Precautionary Statement: | P261, P264, P270, P272, P280, P301+P316, P302+P352, P321, P330, P333+P313, P362+P364, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-111620861-A | BCL-XL inhibitory compound having low cell permeability and antibody drug conjugate including the same | 20141209 |
AU-2008246719-A1 | Bicyclic compound and pharmaceutical use thereof | 20070426 |
CA-2684703-A1 | Bicyclic compound and pharmaceutical use thereof | 20070426 |
CN-101687810-A | Bicyclic compound and pharmaceutical use thereof | 20070426 |
EP-2141150-A1 | Bicyclic compound and pharmaceutical use thereof | 20070426 |
Complexity: | 174 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 276.95998 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 276.95998 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 52.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS