Methyl 2-Diethoxyphosphoryl-2-methoxyacetate - CAS 16141-79-0
Catalog: |
BB059770 |
Product Name: |
Methyl 2-Diethoxyphosphoryl-2-methoxyacetate |
CAS: |
16141-79-0 |
Synonyms: |
(Diethoxyphosphoryl)(methoxy)acetic Acid Methyl Ester; Methoxyphosphono-Acetic Acid Diethyl 1-Methyl Ester |
IUPAC Name: | methyl 2-diethoxyphosphoryl-2-methoxyacetate |
Description: | Methyl 2-diethoxyphosphoryl-2-methoxyacetate is a reagent in a Wittig reaction. |
Molecular Weight: | 240.19 |
Molecular Formula: | C8H17O6P |
Canonical SMILES: | CCOP(=O)(C(C(=O)OC)OC)OCC |
InChI: | InChI=1S/C8H17O6P/c1-5-13-15(10,14-6-2)8(12-4)7(9)11-3/h8H,5-6H2,1-4H3 |
InChI Key: | ORDHSXIQNXYWNF-UHFFFAOYSA-N |
References: | Ribereau, P., et al. Can. J. Chem., 61, 334 (1983). |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P301+P317, P330, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
EP-3131145-A1 | Polymer electrolyte composition and polymer electrolyte membrane, membrane-electrolyte assembly, and solid polymer fuel cell using same | 20140407 |
EP-3131145-B1 | Polymer electrolyte composition and polymer electrolyte membrane, membrane-electrolyte assembly, and solid polymer fuel cell using same | 20140407 |
TW-201603383-A | Polymer electrolyte composition, polymer electrolyte membrane using the same, membrane electrode assembly, and polymer electrolyte fuel cell | 20140407 |
TW-I643394-B | Polymer electrolyte composition, polymer electrolyte membrane using the same, membrane electrode assembly, and polymer electrolyte fuel cell | 20140407 |
US-10103401-B2 | Polymer electrolyte composition and polymer electrolyte membrane, polymer electrolyte membrane with catalyst layer, membrane electrode assembly, and polymer electrolyte fuel cell each using the same | 20140407 |
US-2017125832-A1 | Polymer electrolyte composition and polymer electrolyte membrane, polymer electrolyte membrane with catalyst layer, membrane electrode assembly, and polymer electrolyte fuel cell each using the same | 20140407 |
CA-2944439-C | Polymer electrolyte composition and polymer electrolyte membrane, polymer electrolyte membrane with catalyst layer, membrane electrode assembly, and polymer electrolyte fuel cell each using the same | 20140407 |
AU-2008341671-A1 | Antitumoral compounds | 20071220 |
AU-2008341671-B2 | Antitumoral compounds | 20071220 |
AU-2012216670-A1 | Antitumoral compounds | 20071220 |
Complexity: | 231 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 240.07627526 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 240.07627526 |
Rotatable Bond Count: | 8 |
Topological Polar Surface Area: | 71.1Ų |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Other Building Blocks
Customers Also Viewed
-
[1271-47-2]
Ethynylferrocene
-
[132182-92-4]
Pentane, 1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-(trifluoromethyl)-
-
[332360-02-8]
Mitoguazone dihydrochloride monohydrate
-
[883-44-3]
N-(3-Hydroxypropyl)phthalimide
-
[94086-78-9]
Isopropyl 4-[4-[N,N-bis(2-hydroxyethyl)amino]phenyl]butyrate
-
[1184173-73-6]
MK-8353
INDUSTRY LEADERS TRUST OUR PRODUCTS