Methyl 2-chloro-5-methylnicotinate - CAS 65169-43-9
Catalog: |
BB032646 |
Product Name: |
Methyl 2-chloro-5-methylnicotinate |
CAS: |
65169-43-9 |
Synonyms: |
methyl 2-chloro-5-methylpyridine-3-carboxylate |
IUPAC Name: | methyl 2-chloro-5-methylpyridine-3-carboxylate |
Description: | Methyl 2-chloro-5-methylnicotinate (CAS# 65169-43-9) is a useful research chemical. |
Molecular Weight: | 185.61 |
Molecular Formula: | C8H8ClNO2 |
Canonical SMILES: | CC1=CN=C(C(=C1)C(=O)OC)Cl |
InChI: | InChI=1S/C8H8ClNO2/c1-5-3-6(8(11)12-2)7(9)10-4-5/h3-4H,1-2H3 |
InChI Key: | FOKUGIKLNXFRTI-UHFFFAOYSA-N |
MDL: | MFCD07375372 |
LogP: | 1.83000 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-112574199-A | Heterocyclic compounds as Kras-G12C inhibitors | 20200520 |
CN-112574199-B | Heterocyclic compounds as Kras-G12C inhibitors | 20200520 |
WO-2021115286-A1 | Six-membered and five-membered aromatic ring derivative containing nitrogen heteroatoms which can be used as shp2 inhibitor | 20191210 |
US-2019367530-A1 | Thienopyranones and Furanopyranones as Kinase, Bromodomain, and Checkpoint Inhibitors | 20170127 |
AU-2015374155-A1 | Novel calcium modulators | 20141230 |
Complexity: | 174 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 185.0243562 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 185.0243562 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 39.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS