Methyl 2-Bromo-6-(trifluoromethyl)nicotinate - CAS 144740-56-7
Catalog: |
BB009830 |
Product Name: |
Methyl 2-Bromo-6-(trifluoromethyl)nicotinate |
CAS: |
144740-56-7 |
Synonyms: |
2-bromo-6-(trifluoromethyl)-3-pyridinecarboxylic acid methyl ester; methyl 2-bromo-6-(trifluoromethyl)pyridine-3-carboxylate |
IUPAC Name: | methyl 2-bromo-6-(trifluoromethyl)pyridine-3-carboxylate |
Description: | Methyl 2-Bromo-6-(trifluoromethyl)nicotinate (CAS# 144740-56-7) is a useful research chemical compound. |
Molecular Weight: | 284.03 |
Molecular Formula: | C8H5BrF3NO2 |
Canonical SMILES: | COC(=O)C1=C(N=C(C=C1)C(F)(F)F)Br |
InChI: | InChI=1S/C8H5BrF3NO2/c1-15-7(14)4-2-3-5(8(10,11)12)13-6(4)9/h2-3H,1H3 |
InChI Key: | PEEBGPINNABOSD-UHFFFAOYSA-N |
LogP: | 2.64950 |
Publication Number | Title | Priority Date |
WO-2021080330-A1 | Nicotinamide compound and herbicidal composition comprising compound | 20191021 |
KR-20210047264-A | Nicotinamide Compounds and Herbicide Composition Comprising the Same | 20191021 |
WO-2019149959-A1 | Ghrelin o-acyltransferase inhibitors | 20180205 |
AU-2019213478-A1 | Ghrelin O-acyltransferase inhibitors | 20180205 |
EP-3749304-A1 | Ghrelin o-acyltransferase inhibitors | 20180205 |
Complexity: | 247 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 282.94558 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 282.94558 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 39.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS