Methyl 2-bromo-4-(trifluoromethyl)benzoate - CAS 1214334-90-3
Catalog: |
BB059811 |
Product Name: |
Methyl 2-bromo-4-(trifluoromethyl)benzoate |
CAS: |
1214334-90-3 |
Synonyms: |
Methyl 2-bromo-4-(trifluoromethyl)benzoate; 2-Bromo-4-(trifluoromethyl)benzoic acid methyl ester; Methyl2-bromo-4-(trifluoromethyl)benzoate; METHYL 2-BROMO-4-TRIFLUOROMETHYLBENZOATE |
IUPAC Name: | methyl 2-bromo-4-(trifluoromethyl)benzoate |
Description: | Methyl 2-bromo-4-(trifluoromethyl)benzoate |
Molecular Weight: | 283.04 |
Molecular Formula: | C9H6BrF3O2 |
Canonical SMILES: | COC(=O)C1=C(C=C(C=C1)C(F)(F)F)Br |
InChI: | InChI=1S/C9H6BrF3O2/c1-15-8(14)6-3-2-5(4-7(6)10)9(11,12)13/h2-4H,1H3 |
InChI Key: | BKSKYELSIMPUNZ-UHFFFAOYSA-N |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P317, P302+P352, P304+P340, P317, P321, P330, P332+P317, P362+P364, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021047622-A1 | Pyridine oxynitride, preparation method therefor and use thereof | 20190912 |
WO-2020146682-A1 | Carboxamides as modulators of sodium channels | 20190110 |
TW-202003457-A | Sulfinylaminobenzamide and sulfonylaminobenzamide derivatives | 20180522 |
US-2019359565-A1 | Sulfinylaminobenzamide and sulfonylaminobenzamide derivatives | 20180522 |
WO-2019226490-A1 | Sulfinylaminobenzamide and sulfonylaminobenzamide derivatives | 20180522 |
AU-2019272538-A1 | Sulfinylaminobenzamide and sulfonylaminobenzamide derivatives | 20180522 |
CA-3099051-A1 | Sulfinylaminobenzamide and sulfonylaminobenzamide derivatives | 20180522 |
CN-112204008-A | Sulphonylaminobenzylamide and sulphonylaminobenzamide derivatives | 20180522 |
EP-3796975-A1 | Sulfinylaminobenzamide and sulfonylaminobenzamide derivatives | 20180522 |
KR-20210010925-A | Sulfinylaminobenzamide and sulfonylaminobenzamide derivatives | 20180522 |
Complexity: | 242 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 281.95033 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 281.95033 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 26.3Ų |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Other Building Blocks
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS