Methyl 2-Amino-5-(methylsulfonyl)benzoate - CAS 90610-65-4
Catalog: |
BB039908 |
Product Name: |
Methyl 2-Amino-5-(methylsulfonyl)benzoate |
CAS: |
90610-65-4 |
Synonyms: |
2-amino-5-methylsulfonylbenzoic acid methyl ester; methyl 2-amino-5-methylsulfonylbenzoate |
IUPAC Name: | methyl 2-amino-5-methylsulfonylbenzoate |
Description: | Methyl 2-Amino-5-(methylsulfonyl)benzoate (CAS# 90610-65-4) is a useful research chemical. |
Molecular Weight: | 229.25 |
Molecular Formula: | C9H11NO4S |
Canonical SMILES: | COC(=O)C1=C(C=CC(=C1)S(=O)(=O)C)N |
InChI: | InChI=1S/C9H11NO4S/c1-14-9(11)7-5-6(15(2,12)13)3-4-8(7)10/h3-5H,10H2,1-2H3 |
InChI Key: | DAJZKEMUMLYMDA-UHFFFAOYSA-N |
LogP: | 2.12090 |
GHS Hazard Statement: | H302 (50%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
US-2019359565-A1 | Sulfinylaminobenzamide and sulfonylaminobenzamide derivatives | 20180522 |
WO-2019226490-A1 | Sulfinylaminobenzamide and sulfonylaminobenzamide derivatives | 20180522 |
AU-2019272538-A1 | Sulfinylaminobenzamide and sulfonylaminobenzamide derivatives | 20180522 |
CN-112204008-A | Sulphonylaminobenzylamide and sulphonylaminobenzamide derivatives | 20180522 |
EP-3796975-A1 | Sulfinylaminobenzamide and sulfonylaminobenzamide derivatives | 20180522 |
Complexity: | 333 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 229.04087901 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 229.04087901 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 94.8 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS