Methyl 2,6-Difluoro-4-methylbenzoate - CAS 79538-30-0
Catalog: |
BB036372 |
Product Name: |
Methyl 2,6-Difluoro-4-methylbenzoate |
CAS: |
79538-30-0 |
Synonyms: |
2,6-difluoro-4-methylbenzoic acid methyl ester; methyl 2,6-difluoro-4-methylbenzoate |
IUPAC Name: | methyl 2,6-difluoro-4-methylbenzoate |
Description: | Methyl 2,6-Difluoro-4-methylbenzoate (CAS# 79538-30-0) is a useful research chemical. |
Molecular Weight: | 186.16 |
Molecular Formula: | C9H8F2O2 |
Canonical SMILES: | CC1=CC(=C(C(=C1)F)C(=O)OC)F |
InChI: | InChI=1S/C9H8F2O2/c1-5-3-6(10)8(7(11)4-5)9(12)13-2/h3-4H,1-2H3 |
InChI Key: | UEZGFCDNTINKED-UHFFFAOYSA-N |
LogP: | 2.05980 |
Publication Number | Title | Priority Date |
TW-202030190-A | Imidazopyridine derivatives | 20181030 |
TW-I717080-B | Imidazopyridine derivatives | 20181030 |
WO-2018081285-A1 | Urea-containing isoxazole derivatives as fxr agonists and methods of use thereof | 20161026 |
US-2015057309-A1 | Novel 3,5-disubstituted-3h-imidazo[4,5-b]pyridine and 3,5- disubstituted -3h-[1,2,3]triazolo[4,5-b] pyridine compounds as modulators of c-met protein, etc | 20120330 |
US-2018072721-A1 | Novel 3,5-disubstituted-3h-imidazo[4,5-b]pyridine and 3,5-disubstituted-3h-[1,2,3]triazolo[4,5-b] pyridine compounds as modulators of c-met protein kinases | 20120330 |
Complexity: | 184 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 186.04923582 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 186.04923582 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 26.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS