Methyl 2-(3-pyrazolyl)acetate - CAS 878678-79-6
Catalog: |
BB038663 |
Product Name: |
Methyl 2-(3-pyrazolyl)acetate |
CAS: |
878678-79-6 |
Synonyms: |
2-(1H-pyrazol-5-yl)acetic acid methyl ester; methyl 2-(1H-pyrazol-5-yl)acetate |
IUPAC Name: | methyl 2-(1H-pyrazol-5-yl)acetate |
Description: | Methyl 2-(3-pyrazolyl)acetate (CAS# 878678-79-6) is a useful research chemical. |
Molecular Weight: | 140.14 |
Molecular Formula: | C6H8N2O2 |
Canonical SMILES: | COC(=O)CC1=CC=NN1 |
InChI: | InChI=1S/C6H8N2O2/c1-10-6(9)4-5-2-3-7-8-5/h2-3H,4H2,1H3,(H,7,8) |
InChI Key: | PBWIWDDODPODHV-UHFFFAOYSA-N |
LogP: | 0.00000 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
AU-2017335222-A1 | Heterocyclic compounds and their use in preventing or treating bacterial infections | 20160930 |
AU-2017335222-A2 | Heterocyclic compounds and their use in preventing or treating bacterial infections | 20160930 |
EP-3519411-A1 | Heterocyclic compounds and their use in preventing or treating bacterial infections | 20160930 |
JP-2019530690-A | Heterocyclic compounds and their use in the prevention or treatment of bacterial infections | 20160930 |
US-2019224210-A1 | Heterocyclic compounds and their use in preventing or treating bacterial infections | 20160930 |
Complexity: | 127 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 140.058577502 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 140.058577502 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 55 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS