Methyl 2-[3-(2-chloroethyl)ureido]benzoate - CAS 77093-92-6
Catalog: |
BB035798 |
Product Name: |
Methyl 2-[3-(2-chloroethyl)ureido]benzoate |
CAS: |
77093-92-6 |
Synonyms: |
methyl 2-(2-chloroethylcarbamoylamino)benzoate |
IUPAC Name: | methyl 2-(2-chloroethylcarbamoylamino)benzoate |
Description: | Methyl 2-[3-(2-chloroethyl)ureido]benzoate (CAS# 77093-92-6) is a useful research chemical. |
Molecular Weight: | 256.69 |
Molecular Formula: | C11H13ClN2O3 |
Canonical SMILES: | COC(=O)C1=CC=CC=C1NC(=O)NCCCl |
InChI: | InChI=1S/C11H13ClN2O3/c1-17-10(15)8-4-2-3-5-9(8)14-11(16)13-7-6-12/h2-5H,6-7H2,1H3,(H2,13,14,16) |
InChI Key: | NUKAPQXOPXRWBX-UHFFFAOYSA-N |
Boiling Point: | 372.3 ℃ at 760 mmHg |
Density: | 1.302 g/cm3 |
MDL: | MFCD00209597 |
LogP: | 2.29740 |
Publication Number | Title | Priority Date |
AU-731187-B2 | Diarylalkyl cyclic diamine derivatives as chemokine receptor antagonists | 19960520 |
EP-0914319-B1 | Diarylalkyl cyclic diamine derivatives as chemokine receptor antagonists | 19960520 |
JP-2002503210-A | Diarylalkyl cyclic diamine derivatives and their use as therapeutics | 19960520 |
JP-4176148-B2 | Diarylalkyl cyclic diamine derivatives and their use as therapeutics | 19960520 |
KR-100487692-B1 | Diarylalkylcyclic Diamine Derivatives as Chemokine Receptor Antagonists and Pharmaceutical Compositions Containing them | 19960520 |
Complexity: | 273 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 256.06147 |
Formal Charge: | 0 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 256.06147 |
Rotatable Bond Count: | 5 |
Topological Polar Surface Area: | 67.4 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS