Methyl 2-(2-Amino-5-methyl-4-thiazolyl)acetate - CAS 259654-73-4
Catalog: |
BB019082 |
Product Name: |
Methyl 2-(2-Amino-5-methyl-4-thiazolyl)acetate |
CAS: |
259654-73-4 |
Synonyms: |
2-(2-amino-5-methyl-4-thiazolyl)acetic acid methyl ester; methyl 2-(2-amino-5-methyl-1,3-thiazol-4-yl)acetate |
IUPAC Name: | methyl 2-(2-amino-5-methyl-1,3-thiazol-4-yl)acetate |
Description: | Methyl 2-(2-Amino-5-methyl-4-thiazolyl)acetate (CAS# 259654-73-4) is a useful research chemical. |
Molecular Weight: | 186.23 |
Molecular Formula: | C7H10N2O2S |
Canonical SMILES: | CC1=C(N=C(S1)N)CC(=O)OC |
InChI: | InChI=1S/C7H10N2O2S/c1-4-5(3-6(10)11-2)9-7(8)12-4/h3H2,1-2H3,(H2,8,9) |
InChI Key: | LJTGLNPZNUZMIZ-UHFFFAOYSA-N |
LogP: | 0.67930 |
Publication Number | Title | Priority Date |
TW-202045489-A | Protein secretion inhibitors | 20190228 |
WO-2020176863-A1 | Thiazole derivatives as protein secretion inhibitors | 20190228 |
US-2018153859-A1 | Methods of treating or preventing cognitive impairment using indane acetic acid derivatives based on apoe4 genotype | 20161202 |
US-2018153860-A1 | Methods of dose administration for treating or preventing cognitive impairment using indane acetic acid derivatives | 20161202 |
WO-2018102358-A1 | Methods of treating or preventing cognitive impairment using indane acetic acid derivatives based on apoe4 genotype | 20161202 |
Complexity: | 177 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 186.04629874 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 186.04629874 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 93.4 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS