methyl 2-(2-amino-1,3-thiazol-4-yl)acetate hydrochloride - CAS 76629-18-0
Catalog: |
BB035639 |
Product Name: |
methyl 2-(2-amino-1,3-thiazol-4-yl)acetate hydrochloride |
CAS: |
76629-18-0 |
Synonyms: |
2-(2-amino-4-thiazolyl)acetic acid methyl ester;hydrochloride; methyl 2-(2-amino-1,3-thiazol-4-yl)acetate;hydrochloride |
IUPAC Name: | methyl 2-(2-amino-1,3-thiazol-4-yl)acetate;hydrochloride |
Description: | methyl 2-(2-amino-1,3-thiazol-4-yl)acetate hydrochloride (CAS# 76629-18-0) is a useful research chemical. |
Molecular Weight: | 208.66 |
Molecular Formula: | C6H9ClN2O2S |
Canonical SMILES: | COC(=O)CC1=CSC(=N1)N.Cl |
InChI: | InChI=1S/C6H8N2O2S.ClH/c1-10-5(9)2-4-3-11-6(7)8-4;/h3H,2H2,1H3,(H2,7,8);1H |
InChI Key: | DCLJYTHCPIQKNR-UHFFFAOYSA-N |
MDL: | MFCD03086082 |
LogP: | 1.82400 |
Publication Number | Title | Priority Date |
EP-1587800-A1 | Thiazole derivatives and their use as vap-1 inhibitors | 20030127 |
TW-I336696-B | Thiazole derivatives | 20030127 |
WO-2004067521-A1 | Thiazole derivatives and their use as vap-1 inhibitors | 20030127 |
CA-2413429-A1 | Benzoxazepinones and their use as squalene synthase inhibitors | 20000623 |
CZ-20024151-A3 | Benzoxazepinones, process for their preparation and use | 20000623 |
Complexity: | 154 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 208.0073264 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 208.0073264 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 93.4 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Oxazole/Thiazole
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS