Indole-3-acetic hydrazide - CAS 5448-47-5
Catalog: |
BB028696 |
Product Name: |
Indole-3-acetic hydrazide |
CAS: |
5448-47-5 |
Synonyms: |
2-(1H-indol-3-yl)acetohydrazide |
IUPAC Name: | 2-(1H-indol-3-yl)acetohydrazide |
Description: | Indole-3-acetic hydrazide (CAS# 5448-47-5) is a compound useful in organic synthesis. |
Molecular Weight: | 189.21 |
Molecular Formula: | C10H11N3O |
Canonical SMILES: | C1=CC=C2C(=C1)C(=CN2)CC(=O)NN |
InChI: | InChI=1S/C10H11N3O/c11-13-10(14)5-7-6-12-9-4-2-1-3-8(7)9/h1-4,6,12H,5,11H2,(H,13,14) |
InChI Key: | GYHLCXMCGCVVCG-UHFFFAOYSA-N |
Boiling Point: | 518 °C at 760 mmHg |
Density: | 1.311 g/cm3 |
Appearance: | Off-white/beige solid |
MDL: | MFCD00005634 |
LogP: | 1.79150 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2020065119-A1 | Acylhydrazones for the treatment of neurological diseases | 20180927 |
EP-3858342-A1 | Acylhydrazones for the treatment of neurological diseases | 20180927 |
AU-2018252172-A1 | Selective HDAC6 inhibitors | 20170414 |
CA-3056381-A1 | Selective hdac6 inhibitors | 20170414 |
CN-110546140-A | selective HDAC6 inhibitors | 20170414 |
PMID | Publication Date | Title | Journal |
20489719 | 20100601 | Nucleophilic catalysis of acylhydrazone equilibration for protein-directed dynamic covalent chemistry | Nature chemistry |
Complexity: | 219 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 189.090211983 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 3 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 189.090211983 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 70.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Indoles
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS