Imidazo(1,2-a)pyridine-2-carbaldehyde - CAS 118000-43-4
Catalog: |
BB004040 |
Product Name: |
Imidazo(1,2-a)pyridine-2-carbaldehyde |
CAS: |
118000-43-4 |
Synonyms: |
2-imidazo[1,2-a]pyridinecarboxaldehyde; imidazo[1,2-a]pyridine-2-carbaldehyde |
IUPAC Name: | imidazo[1,2-a]pyridine-2-carbaldehyde |
Description: | Imidazo(1,2-a)pyridine-2-carbaldehyde (CAS# 118000-43-4) is a useful research chemical compound. |
Molecular Weight: | 146.15 |
Molecular Formula: | C8H6N2O |
Canonical SMILES: | C1=CC2=NC(=CN2C=C1)C=O |
InChI: | InChI=1S/C8H6N2O/c11-6-7-5-10-4-2-1-3-8(10)9-7/h1-6H |
InChI Key: | QKKKBOZQZHBENG-UHFFFAOYSA-N |
Boiling Point: | 0 ℃ |
Density: | 1.24 g/cm3 |
Appearance: | Faint yellow to brown powder or crystals |
Storage: | Inert atmosphere, 2-8 ℃ |
MDL: | MFCD06739247 |
LogP: | 1.14680 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P301+P312, P330, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021158481-A1 | Substituted 1,1'-biphenyl compounds and methods using same | 20200203 |
WO-2021122745-A1 | 4-[[(7-aminopyrazolo[1,5-a]pyrimidin-5-yl)amino]methyl]piperidin-3-ol compounds and their therapeutic use | 20191216 |
CN-112574230-A | Peptidyl arginine deiminase inhibitors and uses thereof | 20190927 |
WO-2021057910-A1 | Peptidylarginine deiminase inhibitor and use thereof | 20190927 |
TW-202104222-A | Oxadiazole compounds, applications of the same and methods of producing the same | 20190408 |
Complexity: | 160 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 146.048012819 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 146.048012819 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 34.4 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS