Imidazo[1,2-a]pyridin-6-amine - CAS 235106-53-3
Catalog: |
BB018084 |
Product Name: |
Imidazo[1,2-a]pyridin-6-amine |
CAS: |
235106-53-3 |
Synonyms: |
6-imidazo[1,2-a]pyridinamine; imidazo[1,2-a]pyridin-6-amine |
IUPAC Name: | imidazo[1,2-a]pyridin-6-amine |
Description: | Imidazo[1,2-a]pyridin-6-amine (CAS# 235106-53-3) is a useful research chemical. |
Molecular Weight: | 133.15 |
Molecular Formula: | C7H7N3 |
Canonical SMILES: | C1=CC2=NC=CN2C=C1N |
InChI: | InChI=1S/C7H7N3/c8-6-1-2-7-9-3-4-10(7)5-6/h1-5H,8H2 |
InChI Key: | FBEUDMIHYYXAJG-UHFFFAOYSA-N |
Density: | 1.32 g/cm3 |
Appearance: | Solid |
MDL: | MFCD06739232 |
LogP: | 1.49770 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021064142-A1 | Heterocyclic derivatives, pharmaceutical compositions and their use in the treatment or amelioration of cancer | 20191002 |
WO-2019149657-A1 | Benzyl-, (pyridin-3-yl)methyl- or (pyridin-4-yl)methyl-substituted oxadiazolopyridine derivatives as ghrelin o-acyl transferase (goat) inhibitors | 20180202 |
EP-3733663-A1 | Quinazoline derivative and use thereof | 20171219 |
US-2021078958-A1 | Quinazoline derivative and use thereof | 20171219 |
EP-3431482-B1 | Organometallic compound and organic light-emitting device including the same | 20170721 |
PMID | Publication Date | Title | Journal |
12762738 | 20030530 | Easy access to novel substituted 6-aminoimidazo[1,2-a]pyridines using palladium- and copper-catalyzed aminations | The Journal of organic chemistry |
Complexity: | 126 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 133.063997236 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 133.063997236 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 43.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS