Glycolamide - CAS 598-42-5
Catalog: |
BB030523 |
Product Name: |
Glycolamide |
CAS: |
598-42-5 |
Synonyms: |
2-hydroxyacetamide |
IUPAC Name: | 2-hydroxyacetamide |
Description: | Glycolamide (CAS# 598-42-5) is a useful research chemical. |
Molecular Weight: | 75.07 |
Molecular Formula: | C2H5NO2 |
Canonical SMILES: | C(C(=O)N)O |
InChI: | InChI=1S/C2H5NO2/c3-2(5)1-4/h4H,1H2,(H2,3,5) |
InChI Key: | TZGPACAKMCUCKX-UHFFFAOYSA-N |
Boiling Point: | 281.3 °C at 760 mmHg |
Melting Point: | 118-120 °C (lit.) |
Purity: | 95 % |
Density: | 1.122 g/cm3 |
Appearance: | White to off-white crystals |
MDL: | MFCD00047895 |
LogP: | -0.83570 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2015192119-A1 | Pyrimidine compounds and methods using the same | 20140613 |
WO-2015187089-A1 | Mth1 inhibitors for treatment of inflammatory and autoimmune conditions | 20140604 |
WO-2015173329-A1 | Antibacterial quinazoline-4(3h)-one derivatives | 20140516 |
WO-2015175778-A1 | Lubricating oils | 20140515 |
WO-2015148344-A2 | Trka kinase inhibitors, compositions and methods thereof | 20140326 |
PMID | Publication Date | Title | Journal |
22360688 | 20120319 | Investigation of in situ oxalate formation from 2,3-pyrazinedicarboxylate under hydrothermal conditions using nuclear magnetic resonance spectroscopy | Inorganic chemistry |
22641717 | 20120101 | The dissociation chemistry of ionized methyl carbamate and its isomers revisited: theory and experiment in concert | European journal of mass spectrometry (Chichester, England) |
21859393 | 20111201 | Disposition, metabolism and mass balance of [(14)C]apremilast following oral administration | Xenobiotica; the fate of foreign compounds in biological systems |
21726762 | 20110815 | Extractive spectrophotometric determination of palladium with N,N,N',N'-tetra(2-ethylhexyl)-thiodiglycolamide T(2EH)TDGA | Talanta |
21431107 | 20110428 | Chemical evolution of biomolecule building blocks. Can thermodynamics explain the accumulation of glycine in the prebiotic ocean? | Physical chemistry chemical physics : PCCP |
Complexity: | 42.9 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 75.032028402 |
Formal Charge: | 0 |
Heavy Atom Count: | 5 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 75.032028402 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 63.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -1.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS