Glutaric acid monomethyl ester chloride - CAS 1501-26-4
Catalog: |
BB010489 |
Product Name: |
Glutaric acid monomethyl ester chloride |
CAS: |
1501-26-4 |
Synonyms: |
methyl 5-chloro-5-oxopentanoate |
IUPAC Name: | methyl 5-chloro-5-oxopentanoate |
Description: | Glutaric acid monomethyl ester chloride (CAS# 1501-26-4) is used in the synthesis of Leukotriene B4, a proinflammatory agent produced from leukocytes. |
Molecular Weight: | 164.59 |
Molecular Formula: | C6H9ClO3 |
Canonical SMILES: | COC(=O)CCCC(=O)Cl |
InChI: | InChI=1S/C6H9ClO3/c1-10-6(9)4-2-3-5(7)8/h2-4H2,1H3 |
InChI Key: | JCAZSWWHFJVFPP-UHFFFAOYSA-N |
Boiling Point: | 110 ℃ (17 mmHg) |
Density: | 1.191 g/cm3 |
MDL: | MFCD00000756 |
LogP: | 1.09510 |
GHS Hazard Statement: | H314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation] |
Precautionary Statement: | P260, P264, P280, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-111403810-A | Preparation method of organic flame-retardant electrolyte of lithium ion battery | 20200412 |
WO-2021183913-A1 | Fentanyl haptens, fentanyl hapten conjugates, and methods for making and using | 20200313 |
WO-2021146380-A1 | Boron-containing cyclic emissive compounds and color conversion film containing the same | 20200117 |
WO-2021092446-A1 | Fentanyl hapten, fentanyl hapten-conjugates, and methods for making and using | 20191108 |
WO-2020210761-A1 | Boron-containing cyclic emissive compounds and color conversion film containing the same | 20190412 |
Complexity: | 133 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 164.0240218 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 164.0240218 |
Rotatable Bond Count: | 5 |
Topological Polar Surface Area: | 43.4 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS