exo-Norborneol - CAS 497-37-0
Catalog: |
BB026814 |
Product Name: |
exo-Norborneol |
CAS: |
497-37-0 |
Synonyms: |
(1R,2S,4R)-bicyclo[2.2.1]heptan-2-ol |
IUPAC Name: | (1S,2S,4R)-bicyclo[2.2.1]heptan-2-ol |
Description: | exo-Norborneol (CAS# 497-37-0) is a useful research chemical. |
Molecular Weight: | 112.17 |
Molecular Formula: | C7H12O |
Canonical SMILES: | C1CC2CC1CC2O |
InChI: | InChI=1S/C7H12O/c8-7-4-5-1-2-6(7)3-5/h5-8H,1-4H2/t5-,6-,7+/m1/s1 |
InChI Key: | ZQTYQMYDIHMKQB-QYNIQEEDSA-N |
Boiling Point: | 176-177 °C (lit.) |
Density: | 1.097 g/cm3 |
Appearance: | Solid |
LogP: | 1.16730 |
Publication Number | Title | Priority Date |
EP-3411425-A1 | Antifoam molecules and compositions | 20160202 |
EP-3411465-A1 | Compositions containing antifoams | 20160202 |
US-10611987-B2 | Antifoam molecules containing a silica moiety and compositions | 20160202 |
US-2017218307-A1 | Antifoam molecules and compositions | 20160202 |
US-2017218312-A1 | Compositions containing antifoams | 20160202 |
PMID | Publication Date | Title | Journal |
16261660 | 20060101 | (1)H and (19)F PGSE diffusion and HOESY NMR studies on cationic palladium (II) 1,3-diphenylallyl complexes in THF solution | Magnetic resonance in chemistry : MRC |
11846666 | 20020222 | Inversion vs retention of configuration in gas-phase ammonium ion/alcohol reactions | The Journal of organic chemistry |
Complexity: | 101 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 3 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 112.088815002 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 112.088815002 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 20.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Oxygen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS