exo-6-Hydroxytropinone - CAS 5932-53-6
Catalog: |
BB030347 |
Product Name: |
exo-6-Hydroxytropinone |
CAS: |
5932-53-6 |
Synonyms: |
(1R,5R,6S)-6-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-one |
IUPAC Name: | (1R,5R,6S)-6-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-one |
Description: | exo-6-Hydroxytropinone (CAS# 5932-53-6) is a useful reagent for the preparation of racemic scopolamine (tropane alkaloid). |
Molecular Weight: | 155.19 |
Molecular Formula: | C8H13NO2 |
Canonical SMILES: | CN1C2CC(C1CC(=O)C2)O |
InChI: | InChI=1S/C8H13NO2/c1-9-5-2-6(10)4-7(9)8(11)3-5/h5,7-8,11H,2-4H2,1H3/t5-,7+,8-/m0/s1 |
InChI Key: | UOHSTKWPZWFYTF-ARDNSNSESA-N |
Boiling Point: | 291.6 ℃ at 760 mmHg |
Density: | 1.217 g/cm3 |
Appearance: | Solid |
MDL: | MFCD00005550 |
LogP: | -0.27920 |
Publication Number | Title | Priority Date |
EP-0944627-A1 | 8-azabicyclo 3.2.1]octane-, 8-azabicyclo 3.2.1]oct-6-ene-, 9-azabicyclo 3.3.1]nonane-, 9-aza-3-oxabicyclo 3.3.1]nonane- and 9-aza-3-thiabicyclo 3.3.1]nonane derivatives, their preparation and their use as insecticides | 19961126 |
EP-0944627-B1 | 8-azabicyclo 3.2.1]octane-, 8-azabicyclo 3.2.1]oct-6-ene-, 9-azabicyclo 3.3.1]nonane-, 9-aza-3-oxabicyclo 3.3.1]nonane- and 9-aza-3-thiabicyclo 3.3.1]nonane derivatives, their preparation and their use as insecticides | 19961126 |
US-2002061913-A1 | Bicyclic amine derivatives | 19961126 |
US-5968947-A | Bicyclic amine derivatives | 19961126 |
US-6177442-B1 | Bicyclic amine derivatives | 19961126 |
Complexity: | 193 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 3 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 155.094628657 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 155.094628657 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 40.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS