Ethyl Uracil-6-carboxylate - CAS 1747-53-1
Catalog: |
BB013039 |
Product Name: |
Ethyl Uracil-6-carboxylate |
CAS: |
1747-53-1 |
Synonyms: |
2,4-dioxo-1H-pyrimidine-6-carboxylic acid ethyl ester; ethyl 2,4-dioxo-1H-pyrimidine-6-carboxylate |
IUPAC Name: | ethyl 2,4-dioxo-1H-pyrimidine-6-carboxylate |
Description: | Ethyl Uracil-6-carboxylate (CAS# 1747-53-1 ) is a useful research chemical. |
Molecular Weight: | 184.15 |
Molecular Formula: | C7H8N2O4 |
Canonical SMILES: | CCOC(=O)C1=CC(=O)NC(=O)N1 |
InChI: | InChI=1S/C7H8N2O4/c1-2-13-6(11)4-3-5(10)9-7(12)8-4/h3H,2H2,1H3,(H2,8,9,10,12) |
InChI Key: | OQIITSDYUWKGGR-UHFFFAOYSA-N |
Density: | 1.344 g/cm3 |
LogP: | 0.06450 |
Publication Number | Title | Priority Date |
CA-2884848-A1 | Benzamide and heterobenzamide compounds | 20120928 |
CA-2884848-C | Benzamide and heterobenzamide compounds | 20120928 |
EP-2900653-A1 | Benzamide and heterobenzamide compounds | 20120928 |
JP-2015531366-A | Benzamide and heterobenzamide compounds | 20120928 |
JP-6254169-B2 | Benzamide and heterobenzamide compounds | 20120928 |
PMID | Publication Date | Title | Journal |
19180950 | 20080901 | [Chemical constituents of Solanum cathayanum] | Zhong yao cai = Zhongyaocai = Journal of Chinese medicinal materials |
Complexity: | 295 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 184.04840674 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 184.04840674 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 84.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS