Ethyl o-Phenylenephosphate - CAS 10508-76-6
Catalog: |
BB001550 |
Product Name: |
Ethyl o-Phenylenephosphate |
CAS: |
10508-76-6 |
Synonyms: |
2-ethoxy-1,3,2$l^{5}-benzodioxaphosphole 2-oxide; 2-ethoxy-1,3,2$l^{5}-benzodioxaphosphole 2-oxide |
IUPAC Name: | 2-ethoxy-1,3,2λ5-benzodioxaphosphole 2-oxide |
Description: | Ethyl o-Phenylenephosphate (CAS# 10508-76-6 ) is a useful research chemical. |
Molecular Weight: | 200.13 |
Molecular Formula: | C8H9O4P |
Canonical SMILES: | CCOP1(=O)OC2=CC=CC=C2O1 |
InChI: | InChI=1S/C8H9O4P/c1-2-10-13(9)11-7-5-3-4-6-8(7)12-13/h3-6H,2H2,1H3 |
InChI Key: | FBJABOYDMBHVMO-UHFFFAOYSA-N |
LogP: | 2.60240 |
Publication Number | Title | Priority Date |
US-2006241145-A1 | Piperidine derivative crystal, process for producing the same, and use | 20050421 |
WO-2006115286-A1 | Piperidine derivatives, crystal, process for producing the same, and use as tachikinin receptor antagonists | 20050421 |
CA-2552965-A1 | Carboxamide derivative and use thereof | 20040114 |
EP-1705176-A1 | Carboxamide derivative and use thereof | 20040114 |
JP-WO2005068427-A1 | Carboxamide derivatives and uses thereof | 20040114 |
PMID | Publication Date | Title | Journal |
21807525 | 20110901 | 3-benzhydryl-4-piperidones as novel neurokinin-1 receptor antagonists and their efficient synthesis | Bioorganic & medicinal chemistry |
Complexity: | 212 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 200.02384576 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 200.02384576 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 44.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS