Ethyl Imidazo[1,2-a]pyridine-2-carboxylate - CAS 38922-77-9
Catalog: |
BB023795 |
Product Name: |
Ethyl Imidazo[1,2-a]pyridine-2-carboxylate |
CAS: |
38922-77-9 |
Synonyms: |
2-imidazo[1,2-a]pyridinecarboxylic acid ethyl ester; ethyl imidazo[1,2-a]pyridine-2-carboxylate |
IUPAC Name: | ethyl imidazo[1,2-a]pyridine-2-carboxylate |
Description: | Ethyl Imidazo[1,2-a]pyridine-2-carboxylate (CAS# 38922-77-9) is a useful research chemical. |
Molecular Weight: | 190.20 |
Molecular Formula: | C10H10N2O2 |
Canonical SMILES: | CCOC(=O)C1=CN2C=CC=CC2=N1 |
InChI: | InChI=1S/C10H10N2O2/c1-2-14-10(13)8-7-12-6-4-3-5-9(12)11-8/h3-7H,2H2,1H3 |
InChI Key: | GNFACXDTRBVZJE-UHFFFAOYSA-N |
Density: | 1.22 g/cm3 |
MDL: | MFCD02325394 |
LogP: | 1.51100 |
Publication Number | Title | Priority Date |
WO-2021122745-A1 | 4-[[(7-aminopyrazolo[1,5-a]pyrimidin-5-yl)amino]methyl]piperidin-3-ol compounds and their therapeutic use | 20191216 |
WO-2021099240-A1 | Pyrimidone derivatives containing two fused bicyclic rings | 20191122 |
WO-2021057910-A1 | Peptidylarginine deiminase inhibitor and use thereof | 20190927 |
WO-2020201773-A1 | Mettl3 inhibitory compounds | 20190405 |
US-2021053985-A1 | Benzyl-, (pyridin-3-yl)methyl -or (pyridin-4-yl)-methyl-substiituted oxadiazolopyridine derivatives as ghrelin o-acyl transferase (goat) inhibitors | 20180202 |
Complexity: | 220 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 190.074227566 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 190.074227566 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 43.6 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS