Ethyl Benzothiazole-5-carboxylate - CAS 103261-70-7
Catalog: |
BB001067 |
Product Name: |
Ethyl Benzothiazole-5-carboxylate |
CAS: |
103261-70-7 |
Synonyms: |
1,3-benzothiazole-5-carboxylic acid ethyl ester; ethyl 1,3-benzothiazole-5-carboxylate |
IUPAC Name: | ethyl 1,3-benzothiazole-5-carboxylate |
Description: | Ethyl Benzothiazole-5-carboxylate (CAS# 103261-70-7 ) is a useful research chemical. |
Molecular Weight: | 207.25 |
Molecular Formula: | C10H9NO2S |
Canonical SMILES: | CCOC(=O)C1=CC2=C(C=C1)SC=N2 |
InChI: | InChI=1S/C10H9NO2S/c1-2-13-10(12)7-3-4-9-8(5-7)11-6-14-9/h3-6H,2H2,1H3 |
InChI Key: | ZSBYCGYHRQGYNA-UHFFFAOYSA-N |
LogP: | 2.47300 |
Publication Number | Title | Priority Date |
TW-201919631-A | Pyruvate kinase modulator and use thereof | 20170815 |
JP-2018036516-A | Laminate, transmitted light adjusting material, protective sheet material, spectacle lens and spectacles | 20160831 |
JP-6667405-B2 | Laminate, transmitted light adjusting material, protective sheet material, spectacle lens and spectacles | 20160831 |
JP-2016216638-A | Method for producing azo compound, method for producing aminothienothiazole, and azo compound | 20150522 |
JP-6490495-B2 | Method for producing azo compound, method for producing aminothienothiazole, and azo compound | 20150522 |
Complexity: | 222 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 207.0353997 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 207.0353997 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 67.4 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS