Ethyl 5-Fluoro-2,3-dihydroindene-1-acetate - CAS 904290-44-4
Catalog: |
BB039852 |
Product Name: |
Ethyl 5-Fluoro-2,3-dihydroindene-1-acetate |
CAS: |
904290-44-4 |
Synonyms: |
2-(5-fluoro-2,3-dihydro-1H-inden-1-yl)acetic acid ethyl ester; ethyl 2-(5-fluoro-2,3-dihydro-1H-inden-1-yl)acetate |
IUPAC Name: | ethyl 2-(5-fluoro-2,3-dihydro-1H-inden-1-yl)acetate |
Description: | Ethyl 5-Fluoro-2,3-dihydroindene-1-acetate (CAS# 904290-44-4 ) is a useful research chemical. |
Molecular Weight: | 222.26 |
Molecular Formula: | C13H15FO2 |
Canonical SMILES: | CCOC(=O)CC1CCC2=C1C=CC(=C2)F |
InChI: | InChI=1S/C13H15FO2/c1-2-16-13(15)8-10-4-3-9-7-11(14)5-6-12(9)10/h5-7,10H,2-4,8H2,1H3 |
InChI Key: | GANKZZYXVVRHAW-UHFFFAOYSA-N |
LogP: | 2.80870 |
Publication Number | Title | Priority Date |
EP-2006271-A2 | Substituted bicyclic cyclic derivative and use thereof | 20060330 |
EP-2006271-A9 | Substituted bicyclic cyclic derivative and use thereof | 20060330 |
US-2009054401-A1 | Substituted bicyclic derivatives and use thereof | 20060330 |
AU-2006209543-A1 | Six-membered heterocyclic compound and the use thereof | 20050127 |
AU-2006209543-B2 | Six-membered heterocyclic compound and the use thereof | 20050127 |
Complexity: | 254 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 222.10560788 |
Formal Charge: | 0 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 222.10560788 |
Rotatable Bond Count: | 4 |
Topological Polar Surface Area: | 26.3 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS