Ethyl 5-Benzyl-4,6-dioxo-1,3a,4,5,6,6a-hexahydropyrrolo[3,4-c]pyrazole-3-carboxylate - CAS 134575-05-6
Catalog: |
BB007959 |
Product Name: |
Ethyl 5-Benzyl-4,6-dioxo-1,3a,4,5,6,6a-hexahydropyrrolo[3,4-c]pyrazole-3-carboxylate |
CAS: |
134575-05-6 |
Synonyms: |
4,6-dioxo-5-(phenylmethyl)-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrazole-3-carboxylic acid ethyl ester; ethyl 5-benzyl-4,6-dioxo-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrazole-3-carboxylate |
IUPAC Name: | ethyl 5-benzyl-4,6-dioxo-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrazole-3-carboxylate |
Description: | Ethyl 5-Benzyl-4,6-dioxo-1,3a,4,5,6,6a-hexahydropyrrolo[3,4-c]pyrazole-3-carboxylate (CAS# 134575-05-6) is a useful research chemical. |
Molecular Weight: | 301.30 |
Molecular Formula: | C15H15N3O4 |
Canonical SMILES: | CCOC(=O)C1=NNC2C1C(=O)N(C2=O)CC3=CC=CC=C3 |
InChI: | InChI=1S/C15H15N3O4/c1-2-22-15(21)12-10-11(16-17-12)14(20)18(13(10)19)8-9-6-4-3-5-7-9/h3-7,10-11,16H,2,8H2,1H3 |
InChI Key: | PXMBNSUKLTVWHM-UHFFFAOYSA-N |
Solubility: | 31.5 [ug/mL] (The mean of the results at pH 7.4) |
MDL: | MFCD01031889 |
LogP: | -0.23520 |
Publication Number | Title | Priority Date |
EP-3334729-A1 | Fumagillol spirocyclic compounds and fused bicyclic compounds and their use as metap2 inhibitors | 20150811 |
JP-2018522930-A | Fumagillol spirocyclic compounds and fused bicyclic compounds and their use as METAP2 inhibitors | 20150811 |
US-2018079737-A1 | Fumagillol spirocyclic compounds and fused bicyclic compounds and methods of making and using same | 20150811 |
US-2018237449-A1 | Fumagillol spirocyclic compounds and fused bicyclic compounds and methods of making and using same | 20150811 |
US-2019023716-A1 | Fumagillol spirocyclic compounds and fused bicyclic compounds and methods of making and using same | 20150811 |
Complexity: | 525 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 301.10625597 |
Formal Charge: | 0 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 301.10625597 |
Rotatable Bond Count: | 5 |
Topological Polar Surface Area: | 88.1 |
Undefined Atom Stereocenter Count: | 2 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS