Ethyl 4-(Methylamino)piperidine-1-carboxylate - CAS 73733-69-4
Catalog: |
BB034905 |
Product Name: |
Ethyl 4-(Methylamino)piperidine-1-carboxylate |
CAS: |
73733-69-4 |
Synonyms: |
4-(methylamino)-1-piperidinecarboxylic acid ethyl ester; ethyl 4-(methylamino)piperidine-1-carboxylate |
IUPAC Name: | ethyl 4-(methylamino)piperidine-1-carboxylate |
Description: | Ethyl 4-(Methylamino)piperidine-1-carboxylate (CAS# 73733-69-4) is a useful research chemical. |
Molecular Weight: | 186.25 |
Molecular Formula: | C9H18N2O2 |
Canonical SMILES: | CCOC(=O)N1CCC(CC1)NC |
InChI: | InChI=1S/C9H18N2O2/c1-3-13-9(12)11-6-4-8(10-2)5-7-11/h8,10H,3-7H2,1-2H3 |
InChI Key: | QKPLFXBOWHKIQH-UHFFFAOYSA-N |
Boiling Point: | 267.431 ℃ at 760 mmHg |
Density: | 1.051 g/cm3 |
Appearance: | Clear liquid |
LogP: | 1.15550 |
GHS Hazard Statement: | H302 (33.33%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P321, P322, P330, P332+P313, P337+P313, P362, P363, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
US-10696707-B2 | Polyene macrolide derivative | 20140612 |
US-2017190729-A1 | Polyene macrolide derivative | 20140612 |
US-2019135847-A1 | Polyene macrolide derivative | 20140612 |
EP-2855459-B1 | Aminoquinazoline and pyridopyrimidine derivatives | 20120531 |
US-2016296525-A1 | Aminoquinazoline and pyridopyrimidine derivatives | 20120531 |
Complexity: | 165 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 186.136827821 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 186.136827821 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 41.6 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS