Ethyl 4-Iodobutyrate - CAS 7425-53-8
Catalog: |
BB035036 |
Product Name: |
Ethyl 4-Iodobutyrate |
CAS: |
7425-53-8 |
Synonyms: |
4-iodobutanoic acid ethyl ester; ethyl 4-iodobutanoate |
IUPAC Name: | ethyl 4-iodobutanoate |
Description: | Ethyl 4-Iodobutyrate (CAS# 7425-53-8) is a useful research chemical. |
Molecular Weight: | 242.05 |
Molecular Formula: | C6H11IO2 |
Canonical SMILES: | CCOC(=O)CCCI |
InChI: | InChI=1S/C6H11IO2/c1-2-9-6(8)4-3-5-7/h2-5H2,1H3 |
InChI Key: | RLZFVPPGVAHZPE-UHFFFAOYSA-N |
Boiling Point: | 219.6 ℃ at 760 mmHg |
Density: | 1.614 g/cm3 |
MDL: | MFCD00045325 |
LogP: | 1.76470 |
Publication Number | Title | Priority Date |
CN-110878036-A | Preparation method of [ (1, 2-disulfonyl) ethyl ] aromatic compound | 20190910 |
JP-2020176254-A | Photopolymerizable composition, coating film containing the photopolymerizable composition, and curing method thereof | 20190415 |
JP-2020172599-A | A photoradical polymerizable composition containing a photoradical curing oxygen inhibition reducing agent, a photoradical curing oxygen inhibition reducing agent, a coating film containing a photoradical curing oxygen inhibition reducing agent, and a curing method thereof. | 20190411 |
WO-2020121384-A1 | Photopolymerization sensitizer having migration resistance | 20181210 |
WO-2020121544-A1 | Migration-resistant photopolymerization sensitizer | 20181210 |
Complexity: | 83.1 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 241.98038 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 241.98038 |
Rotatable Bond Count: | 5 |
Topological Polar Surface Area: | 26.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS