Ethyl 4-(4-Pyridyl)-2-thiazolecarboxylate - CAS 216867-38-8
Catalog: |
BB017084 |
Product Name: |
Ethyl 4-(4-Pyridyl)-2-thiazolecarboxylate |
CAS: |
216867-38-8 |
Synonyms: |
4-pyridin-4-yl-2-thiazolecarboxylic acid ethyl ester; ethyl 4-pyridin-4-yl-1,3-thiazole-2-carboxylate |
IUPAC Name: | ethyl 4-pyridin-4-yl-1,3-thiazole-2-carboxylate |
Description: | Ethyl 4-(4-Pyridyl)-2-thiazolecarboxylate (CAS# 216867-38-8) is a useful research chemical. |
Molecular Weight: | 234.27 |
Molecular Formula: | C11H10N2O2S |
Canonical SMILES: | CCOC(=O)C1=NC(=CS1)C2=CC=NC=C2 |
InChI: | InChI=1S/C11H10N2O2S/c1-2-15-11(14)10-13-9(7-16-10)8-3-5-12-6-4-8/h3-7H,2H2,1H3 |
InChI Key: | KMLUEVQSOXDFPY-UHFFFAOYSA-N |
LogP: | 2.38180 |
Publication Number | Title | Priority Date |
CA-2287292-A1 | Sulfonamide derivatives, their production and use | 19970530 |
DE-69835430-T2 | Sulphonamide derivatives, their preparation and their use | 19970530 |
EP-0986551-A1 | Sulfonamide derivatives, their production and use | 19970530 |
EP-0986551-B1 | Sulfonamide derivatives, their production and use | 19970530 |
JP-H11236372-A | Sulfonamide derivative, method for producing the same and agent | 19970530 |
Complexity: | 244 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 234.04629874 |
Formal Charge: | 0 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 234.04629874 |
Rotatable Bond Count: | 4 |
Topological Polar Surface Area: | 80.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS