Ethyl 3-Isoquinolinecarboxylate - CAS 50458-79-2
Catalog: |
BB027064 |
Product Name: |
Ethyl 3-Isoquinolinecarboxylate |
CAS: |
50458-79-2 |
Synonyms: |
3-isoquinolinecarboxylic acid ethyl ester; ethyl isoquinoline-3-carboxylate |
IUPAC Name: | ethyl isoquinoline-3-carboxylate |
Description: | Ethyl 3-Isoquinolinecarboxylate (CAS# 50458-79-2) is a useful research chemical. |
Molecular Weight: | 201.22 |
Molecular Formula: | C12H11NO2 |
Canonical SMILES: | CCOC(=O)C1=CC2=CC=CC=C2C=N1 |
InChI: | InChI=1S/C12H11NO2/c1-2-15-12(14)11-7-9-5-3-4-6-10(9)8-13-11/h3-8H,2H2,1H3 |
InChI Key: | IFSCYCNNAIADLI-UHFFFAOYSA-N |
Boiling Point: | 355.52 °C at 760 mmHg |
Density: | 1.176 g/cm3 |
MDL: | MFCD10566077 |
LogP: | 2.41150 |
GHS Hazard Statement: | H301 (100%): Toxic if swallowed [Danger Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P310, P302+P352, P304+P340, P311, P312, P321, P322, P330, P361, P363, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-111943946-A | Dihydroquinazinone carboxylic acid compound containing nitrogen heterocyclic segment and application thereof | 20200819 |
CN-111410653-A | Dihydroisoquinoline compound | 20190108 |
WO-2020143604-A1 | Dihydroisoquinoline compound | 20190108 |
KR-20210111807-A | Dihydroisoquinoline compounds | 20190108 |
CN-111217811-A | Fused tricyclic compound and application thereof in medicines | 20181126 |
Complexity: | 230 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 201.078978594 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 201.078978594 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 39.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS