Ethyl 3-Benzyl-3-azabicyclo[3.1.0]hexane-6-carboxylate - CAS 186376-30-7
Catalog: |
BB014303 |
Product Name: |
Ethyl 3-Benzyl-3-azabicyclo[3.1.0]hexane-6-carboxylate |
CAS: |
186376-30-7 |
Synonyms: |
3-(phenylmethyl)-3-azabicyclo[3.1.0]hexane-6-carboxylic acid ethyl ester; ethyl 3-benzyl-3-azabicyclo[3.1.0]hexane-6-carboxylate |
IUPAC Name: | ethyl 3-benzyl-3-azabicyclo[3.1.0]hexane-6-carboxylate |
Description: | Ethyl 3-Benzyl-3-azabicyclo[3.1.0]hexane-6-carboxylate (CAS# 186376-30-7) is a useful research chemical compound. |
Molecular Weight: | 245.32 |
Molecular Formula: | C15H19NO2 |
Canonical SMILES: | CCOC(=O)C1C2C1CN(C2)CC3=CC=CC=C3 |
InChI: | InChI=1S/C15H19NO2/c1-2-18-15(17)14-12-9-16(10-13(12)14)8-11-6-4-3-5-7-11/h3-7,12-14H,2,8-10H2,1H3 |
InChI Key: | YUKFHBYDDJRSIY-UHFFFAOYSA-N |
LogP: | 1.86540 |
Publication Number | Title | Priority Date |
US-2018079737-A1 | Fumagillol spirocyclic compounds and fused bicyclic compounds and methods of making and using same | 20150811 |
US-2018237449-A1 | Fumagillol spirocyclic compounds and fused bicyclic compounds and methods of making and using same | 20150811 |
US-2019023716-A1 | Fumagillol spirocyclic compounds and fused bicyclic compounds and methods of making and using same | 20150811 |
US-2019092781-A1 | Fumagillol spirocyclic compounds and fused bicyclic compounds and methods of making and using same | 20150811 |
US-9944613-B2 | Fumagillol spirocyclic compounds and fused bicyclic compounds and methods of making and using same | 20150811 |
Complexity: | 300 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 245.141578849 |
Formal Charge: | 0 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 245.141578849 |
Rotatable Bond Count: | 5 |
Topological Polar Surface Area: | 29.5 |
Undefined Atom Stereocenter Count: | 2 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
-
[7310-97-6]
2,5-Dimethoxybenzene-1,4-dicarboxaldehyde
-
[1032314-85-4]
Benzamide, N-[4-methyl-3-[[4-(6-methyl-3-pyridinyl)-2-pyrimidinyl]amino]phenyl]-4-[(4-methyl-1-piperazinyl)methyl]-
-
[1388152-02-0]
1,2-Cyclopentanediol, 3-amino-5-[(phosphonooxy)methy]-, ammonium salt (1:2), (1R,2S,3R,5R)-
-
[953780-33-1]
(R)-1-[5-(2,2,2-Trifluoroethoxy)-2-pyridyl]ethylamine
-
[72320-38-8]
3-Azidopropanol
-
[2093414-16-3]
1,1'-Bis[3-(trimethylammonio)propyl]ferrocene dichloride
INDUSTRY LEADERS TRUST OUR PRODUCTS