Ethyl 3-(4-Isopropylphenyl)-3-oxopropionate - CAS 54957-66-3
Catalog: |
BB028869 |
Product Name: |
Ethyl 3-(4-Isopropylphenyl)-3-oxopropionate |
CAS: |
54957-66-3 |
Synonyms: |
3-oxo-3-(4-propan-2-ylphenyl)propanoic acid ethyl ester; ethyl 3-oxo-3-(4-propan-2-ylphenyl)propanoate |
IUPAC Name: | ethyl 3-oxo-3-(4-propan-2-ylphenyl)propanoate |
Description: | Ethyl 3-(4-Isopropylphenyl)-3-oxopropionate (CAS# 54957-66-3) is a useful research chemical. |
Molecular Weight: | 234.29 |
Molecular Formula: | C14H18O3 |
Canonical SMILES: | CCOC(=O)CC(=O)C1=CC=C(C=C1)C(C)C |
InChI: | InChI=1S/C14H18O3/c1-4-17-14(16)9-13(15)12-7-5-11(6-8-12)10(2)3/h5-8,10H,4,9H2,1-3H3 |
InChI Key: | FQZYAOSIMPAQNW-UHFFFAOYSA-N |
LogP: | 2.94590 |
Publication Number | Title | Priority Date |
WO-2012093174-A1 | 1-(6-membered azo-heterocyclic)-2,5-dihydro-1h-pyrrol-2-one derivatives as anti-hepatitis c virus, the pharmaceutical composition thereof and their therapeutic use | 20110107 |
CA-1244436-A | 4-quinolone derivatives | 19820614 |
EP-0104959-A1 | 4-Quinolone derivatives | 19820614 |
EP-0104959-B1 | 4-quinolone derivatives | 19820614 |
US-4711898-A | 4-quinolone derivatives having anti-inflammatory, anti-allergic, antitussive, expectorant and antithrombotic activity | 19820614 |
Complexity: | 263 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 234.125594432 |
Formal Charge: | 0 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 234.125594432 |
Rotatable Bond Count: | 6 |
Topological Polar Surface Area: | 43.4 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS