Ethyl 3-(4-Bromophenyl)-2-cyanoacrylate - CAS 18861-58-0
Catalog: |
BB014532 |
Product Name: |
Ethyl 3-(4-Bromophenyl)-2-cyanoacrylate |
CAS: |
18861-58-0 |
Synonyms: |
(E)-3-(4-bromophenyl)-2-cyano-2-propenoic acid ethyl ester; ethyl (E)-3-(4-bromophenyl)-2-cyanoprop-2-enoate |
IUPAC Name: | ethyl (E)-3-(4-bromophenyl)-2-cyanoprop-2-enoate |
Description: | Ethyl 3-(4-Bromophenyl)-2-cyanoacrylate (CAS# 18861-58-0 ) is a useful research chemical. |
Molecular Weight: | 280.12 |
Molecular Formula: | C12H10BrNO2 |
Canonical SMILES: | CCOC(=O)C(=CC1=CC=C(C=C1)Br)C#N |
InChI: | InChI=1S/C12H10BrNO2/c1-2-16-12(15)10(8-14)7-9-3-5-11(13)6-4-9/h3-7H,2H2,1H3/b10-7+ |
InChI Key: | MJGTUYOCBQBORS-JXMROGBWSA-N |
LogP: | 2.91918 |
Publication Number | Title | Priority Date |
EP-3553097-A1 | Copolymer and optical film using same | 20161207 |
US-2020095358-A1 | Copolymer and optical film using same | 20161207 |
US-2017275260-A1 | Allosteric modulators of nicotinic acetylcholine receptors | 20160322 |
US-2018030007-A1 | Allosteric modulators of nicotinic acetylcholine receptors | 20160322 |
US-9840481-B2 | Allosteric modulators of nicotinic acetylcholine receptors | 20160322 |
Complexity: | 321 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 1 |
Exact Mass: | 278.98949 |
Formal Charge: | 0 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 278.98949 |
Rotatable Bond Count: | 4 |
Topological Polar Surface Area: | 50.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS