Ethyl 3-[4-(Benzyloxy)-3,5-dimethoxyphenyl]acrylate - CAS 178239-00-4
Catalog: |
BB013421 |
Product Name: |
Ethyl 3-[4-(Benzyloxy)-3,5-dimethoxyphenyl]acrylate |
CAS: |
178239-00-4 |
Synonyms: |
3-(3,5-dimethoxy-4-phenylmethoxyphenyl)-2-propenoic acid ethyl ester; ethyl 3-(3,5-dimethoxy-4-phenylmethoxyphenyl)prop-2-enoate |
IUPAC Name: | ethyl 3-(3,5-dimethoxy-4-phenylmethoxyphenyl)prop-2-enoate |
Description: | Ethyl 3-[4-(Benzyloxy)-3,5-dimethoxyphenyl]acrylate (CAS# 178239-00-4 ) is a useful research chemical. |
Molecular Weight: | 342.39 |
Molecular Formula: | C20H22O5 |
Canonical SMILES: | CCOC(=O)C=CC1=CC(=C(C(=C1)OC)OCC2=CC=CC=C2)OC |
InChI: | InChI=1S/C20H22O5/c1-4-24-19(21)11-10-16-12-17(22-2)20(18(13-16)23-3)25-14-15-8-6-5-7-9-15/h5-13H,4,14H2,1-3H3 |
InChI Key: | GKKZGNPDSLCFAN-UHFFFAOYSA-N |
LogP: | 3.85910 |
Publication Number | Title | Priority Date |
JP-H09136877-A | Heterocyclic compound, production method and use thereof | 19950616 |
WO-9700249-A1 | Heterocyclic compounds, their production and use | 19950616 |
AU-701847-B2 | Oxazolidinedione derivatives, their production and use | 19941102 |
CA-2161944-A1 | Oxazolidinedione derivatives, their production and use | 19941102 |
CN-1129698-A | Oxazolidinedione derivatives, their production and use | 19941102 |
Complexity: | 402 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 342.1467238 |
Formal Charge: | 0 |
Heavy Atom Count: | 25 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 342.1467238 |
Rotatable Bond Count: | 9 |
Topological Polar Surface Area: | 54 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 1 |
XLogP3: | 4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS